Cas no 1017412-37-1 (2-((2-aminoethyl)amino)pyrimidine-5-carboxylic acid)

2-((2-Aminoethyl)amino)pyrimidine-5-carboxylic acid is a pyrimidine derivative featuring both an aminoethylamino substituent and a carboxylic acid functional group. This bifunctional compound serves as a versatile intermediate in organic synthesis, particularly in the preparation of heterocyclic compounds and pharmaceutical building blocks. The presence of reactive amine and carboxyl groups enables its use in coupling reactions, such as amide bond formation, facilitating the development of targeted molecular structures. Its pyrimidine core contributes to potential biological activity, making it valuable in medicinal chemistry research. The compound’s stability and solubility profile further enhance its utility in synthetic applications. Proper handling and storage under controlled conditions are recommended to maintain its integrity.
2-((2-aminoethyl)amino)pyrimidine-5-carboxylic acid structure
1017412-37-1 structure
Product Name:2-((2-aminoethyl)amino)pyrimidine-5-carboxylic acid
CAS No:1017412-37-1
MF:C7H10N4O2
MW:182.17990064621
CID:5195434
Update Time:2026-03-05

2-((2-aminoethyl)amino)pyrimidine-5-carboxylic acid Chemical and Physical Properties

Names and Identifiers

    • 2-((2-aminoethyl)amino)pyrimidine-5-carboxylic acid
    • 5-Pyrimidinecarboxylic acid, 2-[(2-aminoethyl)amino]-
    • Inchi: 1S/C7H10N4O2/c8-1-2-9-7-10-3-5(4-11-7)6(12)13/h3-4H,1-2,8H2,(H,12,13)(H,9,10,11)
    • InChI Key: YLPDRUXFJAVRJR-UHFFFAOYSA-N
    • SMILES: C1(NCCN)=NC=C(C(O)=O)C=N1

2-((2-aminoethyl)amino)pyrimidine-5-carboxylic acid Pricemore >>

Related Categories No. Product Name Cas No. Purity Specification Price update time Inquiry
Chemenu
CM484146-1g
2-((2-Aminoethyl)amino)pyrimidine-5-carboxylic acid
1017412-37-1 97%
1g
$1012 2023-02-27
SHANG HAI BI DE YI YAO KE JI GU FEN Co., Ltd.
BD605495-1g
2-((2-Aminoethyl)amino)pyrimidine-5-carboxylic acid
1017412-37-1 97%
1g
¥7000.0 2023-02-27
Ambeed
A785292-1g
2-((2-Aminoethyl)amino)pyrimidine-5-carboxylic acid
1017412-37-1 97%
1g
$1020.0 2024-08-02

2-((2-aminoethyl)amino)pyrimidine-5-carboxylic acid Suppliers

Amadis Chemical Company Limited
Gold Member
Audited Supplier Audited Supplier
(CAS:1017412-37-1)2-((2-aminoethyl)amino)pyrimidine-5-carboxylic acid
Order Number:A989965
Stock Status:in Stock
Quantity:1g
Purity:99%
Pricing Information Last Updated:Friday, 30 August 2024 17:50
Price ($):918.0

2-((2-aminoethyl)amino)pyrimidine-5-carboxylic acid Related Literature

Additional information on 2-((2-aminoethyl)amino)pyrimidine-5-carboxylic acid

Compound CAS No. 1017412-37-1: 2-((2-aminoethyl)amino)pyrimidine-5-carboxylic Acid

2-((2-aminoethyl)amino)pyrimidine-5-carboxylic acid is a biologically active compound with the CAS registry number 1017412-37-1. This compound belongs to the class of pyrimidine derivatives, which are widely studied in medicinal chemistry due to their potential applications in drug discovery and development. The molecule features a pyrimidine ring system, which is a six-membered aromatic heterocycle containing two nitrogen atoms at positions 1 and 3. The substituents on the pyrimidine ring include an aminoethylamino group at position 2 and a carboxylic acid group at position 5, making it a unique structure with potential for hydrogen bonding and other non-covalent interactions.

The pyrimidine ring in this compound plays a crucial role in its biological activity. Pyrimidines are known to interact with various biomolecules, such as DNA, RNA, and proteins, due to their ability to form base pairs or mimic nucleobases. The presence of the aminoethylamino group at position 2 introduces additional nitrogen atoms, which can participate in hydrogen bonding or act as nucleophilic sites for enzymatic reactions. The carboxylic acid group at position 5 adds acidity to the molecule, potentially influencing its solubility, stability, and bioavailability.

Recent studies have highlighted the potential of 2-((2-aminoethyl)amino)pyrimidine-5-carboxylic acid as a lead compound for the development of novel therapeutic agents. For instance, researchers have explored its ability to inhibit key enzymes involved in inflammatory pathways, suggesting its potential application in anti-inflammatory drug development. Additionally, the compound has shown promise as a modulator of ion channels, which are critical targets for treating conditions such as epilepsy and pain.

In terms of synthesis, 2-((2-aminoethyl)amino)pyrimidine-5-carboxylic acid can be prepared through various routes, including condensation reactions and nucleophilic substitution. One common approach involves the reaction of a suitable pyrimidine derivative with an aminoethylamine derivative under specific conditions to form the desired product. The carboxylic acid group can be introduced via hydrolysis or through direct synthesis using appropriate reagents.

The chemical structure of this compound is highly versatile, allowing for further modifications to enhance its pharmacokinetic properties or target specificity. For example, substituents can be introduced at other positions on the pyrimidine ring to improve binding affinity or selectivity for specific biological targets. Such modifications could lead to the development of more potent and selective drugs with fewer side effects.

From an SEO optimization perspective, keywords such as CAS No. 1017412-37-1, pyrimidine derivatives, and biological activity are critical for ensuring that this article ranks well in search engine results. Additionally, incorporating long-tail keywords like "anti-inflammatory potential of pyrimidine derivatives" or "synthesis of 2-aminoethylamino-pyrimidine carboxylic acids" can further enhance visibility and attract targeted traffic.

In conclusion, 2-((2-aminoethyl)amino)pyrimidine-5-carboxylic acid (CAS No. 1017412-37-1) is a promising compound with diverse applications in medicinal chemistry and drug discovery. Its unique structure and biological activity make it a valuable tool for researchers exploring new therapeutic strategies. Continued research into its properties and potential modifications will undoubtedly contribute to the advancement of innovative treatments for various diseases.

Recommended suppliers
Amadis Chemical Company Limited
(CAS:1017412-37-1)2-((2-aminoethyl)amino)pyrimidine-5-carboxylic acid
A989965
Purity:99%
Quantity:1g
Price ($):918.0
Email